C19H31NO4 — CID 24877337
2-amino-2-[6-(2-butoxyethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,3-diol (PubChem CID 24877337) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-amino-2-[6-(2-butoxyethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,3-diol.
| Compound Name | 2-amino-2-[6-(2-butoxyethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 24877337 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 2-amino-2-[6-(2-butoxyethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,3-diol |
| SMILES | CCCCOCCOc1ccc2c(c1)CCC(C(N)(CO)CO)C2 |
| InChI | InChI=1S/C19H31NO4/c1-2-3-8-23-9-10-24-18-7-5-15-11-17(6-4-16(15)12-18)19(20,13-21)14-22/h5,7,12,17,21-22H,2-4,6,8-11,13-14,20H2,1H3 |
| InChIKey | PGKJFRZDIBRYQK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|