C21H35NO3 — CID 25018295
2-amino-2-(2-heptoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)propane-1,3-diol (PubChem CID 25018295) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is 2-amino-2-(2-heptoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)propane-1,3-diol.
| Compound Name | 2-amino-2-(2-heptoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 25018295 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | 2-amino-2-(2-heptoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)propane-1,3-diol |
| SMILES | CCCCCCCOc1ccc2c(c1)CCCC(C(N)(CO)CO)C2 |
| InChI | InChI=1S/C21H35NO3/c1-2-3-4-5-6-12-25-20-11-10-18-13-19(21(22,15-23)16-24)9-7-8-17(18)14-20/h10-11,14,19,23-24H,2-9,12-13,15-16,22H2,1H3 |
| InChIKey | JYOLYNGZGLHRAY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|