C17H26O2 — CID 107684624
5-octoxy-2,3-dihydro-1H-inden-1-ol (PubChem CID 107684624) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 5-octoxy-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-octoxy-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 107684624 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 5-octoxy-2,3-dihydro-1H-inden-1-ol |
| SMILES | CCCCCCCCOc1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C17H26O2/c1-2-3-4-5-6-7-12-19-15-9-10-16-14(13-15)8-11-17(16)18/h9-10,13,17-18H,2-8,11-12H2,1H3 |
| InChIKey | RDILKYABSDPQIH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|