C15H22O3 — CID 114091316
(1R)-5-[2-(2-methylpropoxy)ethoxy]-2,3-dihydro-1H-inden-1-ol (PubChem CID 114091316) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R)-5-[2-(2-methylpropoxy)ethoxy]-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R)-5-[2-(2-methylpropoxy)ethoxy]-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 114091316 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R)-5-[2-(2-methylpropoxy)ethoxy]-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC(C)COCCOc1ccc2c(c1)CC[C@H]2O |
| InChI | InChI=1S/C15H22O3/c1-11(2)10-17-7-8-18-13-4-5-14-12(9-13)3-6-15(14)16/h4-5,9,11,15-16H,3,6-8,10H2,1-2H3/t15-/m1/s1 |
| InChIKey | GQFYLWNMJDUPGB-OAHLLOKOSA-N |
| XLogP | 2.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|