C13H15NO2 — CID 107684826
4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanenitrile (PubChem CID 107684826) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanenitrile.
| Compound Name | 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanenitrile |
|---|---|
| PubChem CID | 107684826 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanenitrile |
| SMILES | N#CCCCOc1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C13H15NO2/c14-7-1-2-8-16-11-4-5-12-10(9-11)3-6-13(12)15/h4-5,9,13,15H,1-3,6,8H2 |
| InChIKey | PBJLLHMVXBTZNB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|