methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate

C14H18O4 — CID 107684768

IUPACmethyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate
SMILESCOC(=O)CCCOc1ccc2c(c1)CCC2O
InChIInChI=1S/C14H18O4/c1-17-14(16)3-2-8-18-11-5-6-12-10(9-11)4-7-13(12)15/h5-6,9,13,15H,2-4,7-8H2,1H3
InChIKeyRIANJUJOZNSXFK-UHFFFAOYSA-N
MW250.29 g/mol
LogP2.00
Rot. Bonds5

About methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate

methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate (PubChem CID 107684768) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate.

Molecular Properties

Compound Namemethyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate
PubChem CID107684768
Molecular FormulaC14H18O4
Molecular Weight250.29 g/mol
Exact Mass250.12
IUPAC Namemethyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate
SMILESCOC(=O)CCCOc1ccc2c(c1)CCC2O
InChIInChI=1S/C14H18O4/c1-17-14(16)3-2-8-18-11-5-6-12-10(9-11)4-7-13(12)15/h5-6,9,13,15H,2-4,7-8H2,1H3
InChIKeyRIANJUJOZNSXFK-UHFFFAOYSA-N
XLogP2.00
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.29
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate?
The IUPAC name of methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate (CID 107684768) is methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate.
What is the SMILES notation for methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate?
The canonical SMILES for methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate is COC(=O)CCCOc1ccc2c(c1)CCC2O.
What is the InChIKey of methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate?
The InChIKey is RIANJUJOZNSXFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-17-14(16)3-2-8-18-11-5-6-12-10(9-11)4-7-13(12)15/h5-6,9,13,15H,2-4,7-8H2,1H3.
What are the key properties of methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate?
methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate has a molecular weight of 250.29 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]butanoate is sourced from PubChem (CID 107684768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).