C14H17NO4 — CID 13109798
methyl 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoate (PubChem CID 13109798) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoate.
| Compound Name | methyl 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoate |
|---|---|
| PubChem CID | 13109798 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H17NO4/c1-18-14(17)3-2-8-19-11-5-6-12-10(9-11)4-7-13(16)15-12/h5-6,9H,2-4,7-8H2,1H3,(H,15,16) |
| InChIKey | FTVJERROOYUOEO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|