C19H27NO4 — CID 78858511
3,3-dimethylbutyl 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoate (PubChem CID 78858511) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3,3-dimethylbutyl 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoate.
| Compound Name | 3,3-dimethylbutyl 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoate |
|---|---|
| PubChem CID | 78858511 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3,3-dimethylbutyl 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoate |
| SMILES | CC(C)(C)CCOC(=O)CCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C19H27NO4/c1-19(2,3)10-12-24-18(22)5-4-11-23-15-7-8-16-14(13-15)6-9-17(21)20-16/h7-8,13H,4-6,9-12H2,1-3H3,(H,20,21) |
| InChIKey | VTWAWGSJLSSCIZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|