C17H22N2O5 — CID 119221434
3-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]butanoic acid (PubChem CID 119221434) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 3-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]butanoic acid.
| Compound Name | 3-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119221434 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)CCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H22N2O5/c1-11(9-17(22)23)18-15(20)3-2-8-24-13-5-6-14-12(10-13)4-7-16(21)19-14/h5-6,10-11H,2-4,7-9H2,1H3,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | SCMKJASVYOHMAP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|