C18H26ClN3O3 — CID 119615003
N-(2-amino-1-cyclopropylethyl)-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide;hydrochloride (PubChem CID 119615003) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119615003 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)CCCOc1ccc2c(c1)CCC(=O)N2)C1CC1 |
| InChI | InChI=1S/C18H25N3O3.ClH/c19-11-16(12-3-4-12)21-17(22)2-1-9-24-14-6-7-15-13(10-14)5-8-18(23)20-15;/h6-7,10,12,16H,1-5,8-9,11,19H2,(H,20,23)(H,21,22);1H |
| InChIKey | RLKDUKHUVMZYTQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|