C21H24N2O4 — CID 97254517
N-[(1R)-2-hydroxy-1-phenylethyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide (PubChem CID 97254517) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-[(1R)-2-hydroxy-1-phenylethyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide.
| Compound Name | N-[(1R)-2-hydroxy-1-phenylethyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
|---|---|
| PubChem CID | 97254517 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[(1R)-2-hydroxy-1-phenylethyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
| SMILES | O=C1CCc2cc(OCCCC(=O)N[C@@H](CO)c3ccccc3)ccc2N1 |
| InChI | InChI=1S/C21H24N2O4/c24-14-19(15-5-2-1-3-6-15)23-20(25)7-4-12-27-17-9-10-18-16(13-17)8-11-21(26)22-18/h1-3,5-6,9-10,13,19,24H,4,7-8,11-12,14H2,(H,22,26)(H,23,25)/t19-/m0/s1 |
| InChIKey | XFLVMARITCDONB-IBGZPJMESA-N |
| XLogP | 2.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|