C26H26N2O4 — CID 55688683
4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[(3-phenoxyphenyl)methyl]butanamide (PubChem CID 55688683) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[(3-phenoxyphenyl)methyl]butanamide.
| Compound Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[(3-phenoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 55688683 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[(3-phenoxyphenyl)methyl]butanamide |
| SMILES | O=C(CCCOc1ccc2c(c1)CCC(=O)N2)NCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H26N2O4/c29-25(10-5-15-31-22-12-13-24-20(17-22)11-14-26(30)28-24)27-18-19-6-4-9-23(16-19)32-21-7-2-1-3-8-21/h1-4,6-9,12-13,16-17H,5,10-11,14-15,18H2,(H,27,29)(H,28,30) |
| InChIKey | ZKUPIQFAZOLECP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|