C22H25N3O5 — CID 55963525
methyl N-[4-[[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]methyl]phenyl]carbamate (PubChem CID 55963525) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is methyl N-[4-[[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55963525 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | methyl N-[4-[[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(CNC(=O)CCCOc2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C22H25N3O5/c1-29-22(28)24-17-7-4-15(5-8-17)14-23-20(26)3-2-12-30-18-9-10-19-16(13-18)6-11-21(27)25-19/h4-5,7-10,13H,2-3,6,11-12,14H2,1H3,(H,23,26)(H,24,28)(H,25,27) |
| InChIKey | ZOPGGNSZAGYCGE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|