C25H32N4O3 — CID 55971867
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide (PubChem CID 55971867) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
|---|---|
| PubChem CID | 55971867 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
| SMILES | O=C(CCCOc1ccc2c(c1)CCC(=O)N2)NCc1ccc(N2CCCCCC2)nc1 |
| InChI | InChI=1S/C25H32N4O3/c30-24(6-5-15-32-21-9-10-22-20(16-21)8-12-25(31)28-22)27-18-19-7-11-23(26-17-19)29-13-3-1-2-4-14-29/h7,9-11,16-17H,1-6,8,12-15,18H2,(H,27,30)(H,28,31) |
| InChIKey | ZRGXYXCPEVYTMB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|