C20H25N3O2 — CID 38527586
4-phenoxy-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]butanamide (PubChem CID 38527586) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-phenoxy-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]butanamide.
| Compound Name | 4-phenoxy-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]butanamide |
|---|---|
| PubChem CID | 38527586 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 4-phenoxy-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]butanamide |
| SMILES | O=C(CCCOc1ccccc1)NCc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C20H25N3O2/c24-20(9-6-14-25-18-7-2-1-3-8-18)22-16-17-10-11-19(21-15-17)23-12-4-5-13-23/h1-3,7-8,10-11,15H,4-6,9,12-14,16H2,(H,22,24) |
| InChIKey | CXOWXFLHKJBMMU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|