C21H25ClN4O2 — CID 37482931
4-chloro-N-[4-oxo-4-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]butyl]benzamide (PubChem CID 37482931) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is 4-chloro-N-[4-oxo-4-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]butyl]benzamide.
| Compound Name | 4-chloro-N-[4-oxo-4-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]butyl]benzamide |
|---|---|
| PubChem CID | 37482931 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-chloro-N-[4-oxo-4-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)NCc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C21H25ClN4O2/c22-18-8-6-17(7-9-18)21(28)23-11-3-4-20(27)25-15-16-5-10-19(24-14-16)26-12-1-2-13-26/h5-10,14H,1-4,11-13,15H2,(H,23,28)(H,25,27) |
| InChIKey | CRJJDSHZMASGPX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|