C18H22N4O2S — CID 37482217
N-[3-oxo-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]propyl]thiophene-3-carboxamide (PubChem CID 37482217) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[3-oxo-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]propyl]thiophene-3-carboxamide.
| Compound Name | N-[3-oxo-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]propyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 37482217 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[3-oxo-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]propyl]thiophene-3-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccsc1)NCc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C18H22N4O2S/c23-17(5-7-19-18(24)15-6-10-25-13-15)21-12-14-3-4-16(20-11-14)22-8-1-2-9-22/h3-4,6,10-11,13H,1-2,5,7-9,12H2,(H,19,24)(H,21,23) |
| InChIKey | PFDJMGKXLVTMRI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |