C19H21F2N3O — CID 53149087
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3,4-difluorobenzamide (PubChem CID 53149087) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3,4-difluorobenzamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 53149087 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3,4-difluorobenzamide |
| SMILES | O=C(NCc1ccc(N2CCCCCC2)nc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H21F2N3O/c20-16-7-6-15(11-17(16)21)19(25)23-13-14-5-8-18(22-12-14)24-9-3-1-2-4-10-24/h5-8,11-12H,1-4,9-10,13H2,(H,23,25) |
| InChIKey | BCFVXOVFTXPWDR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |