C20H23F2N3O2 — CID 55749833
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(difluoromethoxy)benzamide (PubChem CID 55749833) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(difluoromethoxy)benzamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 55749833 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(difluoromethoxy)benzamide |
| SMILES | O=C(NCc1ccc(N2CCCCCC2)nc1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C20H23F2N3O2/c21-20(22)27-17-7-5-6-16(12-17)19(26)24-14-15-8-9-18(23-13-15)25-10-3-1-2-4-11-25/h5-9,12-13,20H,1-4,10-11,14H2,(H,24,26) |
| InChIKey | TZNOFDFVGDEZLA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |