C23H25N5O3 — CID 55972180
4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]butanamide (PubChem CID 55972180) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]butanamide.
| Compound Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55972180 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]butanamide |
| SMILES | O=C(CCCOc1ccc2c(c1)CCC(=O)N2)NCc1cccc(Cn2cncn2)c1 |
| InChI | InChI=1S/C23H25N5O3/c29-22(25-13-17-3-1-4-18(11-17)14-28-16-24-15-26-28)5-2-10-31-20-7-8-21-19(12-20)6-9-23(30)27-21/h1,3-4,7-8,11-12,15-16H,2,5-6,9-10,13-14H2,(H,25,29)(H,27,30) |
| InChIKey | NPIHOFBQYDEYMI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|