C25H31N3O3 — CID 55674201
4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[3-(piperidin-1-ylmethyl)phenyl]butanamide (PubChem CID 55674201) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[3-(piperidin-1-ylmethyl)phenyl]butanamide.
| Compound Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[3-(piperidin-1-ylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 55674201 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[3-(piperidin-1-ylmethyl)phenyl]butanamide |
| SMILES | O=C(CCCOc1ccc2c(c1)CCC(=O)N2)Nc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C25H31N3O3/c29-24(26-21-7-4-6-19(16-21)18-28-13-2-1-3-14-28)8-5-15-31-22-10-11-23-20(17-22)9-12-25(30)27-23/h4,6-7,10-11,16-17H,1-3,5,8-9,12-15,18H2,(H,26,29)(H,27,30) |
| InChIKey | KDUOUDCDUYUGNG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|