C22H25N3O3 — CID 24650648
6-[2-(4-benzylpiperazin-1-yl)-2-oxoethoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 24650648) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 6-[2-(4-benzylpiperazin-1-yl)-2-oxoethoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-(4-benzylpiperazin-1-yl)-2-oxoethoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 24650648 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 6-[2-(4-benzylpiperazin-1-yl)-2-oxoethoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(OCC(=O)N3CCN(Cc4ccccc4)CC3)ccc2N1 |
| InChI | InChI=1S/C22H25N3O3/c26-21-9-6-18-14-19(7-8-20(18)23-21)28-16-22(27)25-12-10-24(11-13-25)15-17-4-2-1-3-5-17/h1-5,7-8,14H,6,9-13,15-16H2,(H,23,26) |
| InChIKey | JWDNNJFJMBXTHQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |