C26H33N3O3 — CID 55673381
6-[4-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 55673381) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 6-[4-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 55673381 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 6-[4-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1ccccc1CN1CCCN(C(=O)CCCOc2ccc3c(c2)CCC(=O)N3)CC1 |
| InChI | InChI=1S/C26H33N3O3/c1-20-6-2-3-7-22(20)19-28-13-5-14-29(16-15-28)26(31)8-4-17-32-23-10-11-24-21(18-23)9-12-25(30)27-24/h2-3,6-7,10-11,18H,4-5,8-9,12-17,19H2,1H3,(H,27,30) |
| InChIKey | BJZIRNITVHJIDM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|