C18H26ClN3O3 — CID 119416167
6-[4-(1,4-diazepan-1-yl)-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride (PubChem CID 119416167) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is 6-[4-(1,4-diazepan-1-yl)-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride.
| Compound Name | 6-[4-(1,4-diazepan-1-yl)-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119416167 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 6-[4-(1,4-diazepan-1-yl)-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| SMILES | Cl.O=C1CCc2cc(OCCCC(=O)N3CCCNCC3)ccc2N1 |
| InChI | InChI=1S/C18H25N3O3.ClH/c22-17-7-4-14-13-15(5-6-16(14)20-17)24-12-1-3-18(23)21-10-2-8-19-9-11-21;/h5-6,13,19H,1-4,7-12H2,(H,20,22);1H |
| InChIKey | HTOQXMJJFKBSKP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|