C16H23N3O2 — CID 13054218
6-(3-piperazin-1-ylpropoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 13054218) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 6-(3-piperazin-1-ylpropoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(3-piperazin-1-ylpropoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 13054218 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 6-(3-piperazin-1-ylpropoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(OCCCN3CCNCC3)ccc2N1 |
| InChI | InChI=1S/C16H23N3O2/c20-16-5-2-13-12-14(3-4-15(13)18-16)21-11-1-8-19-9-6-17-7-10-19/h3-4,12,17H,1-2,5-11H2,(H,18,20) |
| InChIKey | PFNKBBJKVHOPFI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|