C19H21Cl2NO2S — CID 88753256
1,4-dichlorobenzene;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 88753256) has the molecular formula C19H21Cl2NO2S and a molecular weight of 398.36 g/mol. Its IUPAC name is 1,4-dichlorobenzene;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 1,4-dichlorobenzene;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 88753256 |
| Molecular Formula | C19H21Cl2NO2S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1,4-dichlorobenzene;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Clc1ccc(Cl)cc1.O=C1CCc2cc(OCCCCS)ccc2N1 |
| InChI | InChI=1S/C13H17NO2S.C6H4Cl2/c15-13-6-3-10-9-11(4-5-12(10)14-13)16-7-1-2-8-17;7-5-1-2-6(8)4-3-5/h4-5,9,17H,1-3,6-8H2,(H,14,15);1-4H |
| InChIKey | YCDPGNAKBDERPT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|