C20H25NO3S — CID 88692964
anisole;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 88692964) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is anisole;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | anisole;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 88692964 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | anisole;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1ccccc1.O=C1CCc2cc(OCCCCS)ccc2N1 |
| InChI | InChI=1S/C13H17NO2S.C7H8O/c15-13-6-3-10-9-11(4-5-12(10)14-13)16-7-1-2-8-17;1-8-7-5-3-2-4-6-7/h4-5,9,17H,1-3,6-8H2,(H,14,15);2-6H,1H3 |
| InChIKey | HZDSFWCYRPHAOW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|