C18H22N2O2S — CID 88752389
pyridine;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 88752389) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is pyridine;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | pyridine;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 88752389 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | pyridine;6-(4-sulfanylbutoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(OCCCCS)ccc2N1.c1ccncc1 |
| InChI | InChI=1S/C13H17NO2S.C5H5N/c15-13-6-3-10-9-11(4-5-12(10)14-13)16-7-1-2-8-17;1-2-4-6-5-3-1/h4-5,9,17H,1-3,6-8H2,(H,14,15);1-5H |
| InChIKey | QPOQSLRXQWYKME-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|