C14H19N3O3 — CID 63576665
5-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pentanehydrazide (PubChem CID 63576665) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 5-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pentanehydrazide.
| Compound Name | 5-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pentanehydrazide |
|---|---|
| PubChem CID | 63576665 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 5-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pentanehydrazide |
| SMILES | NNC(=O)CCCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H19N3O3/c15-17-14(19)3-1-2-8-20-11-5-6-12-10(9-11)4-7-13(18)16-12/h5-6,9H,1-4,7-8,15H2,(H,16,18)(H,17,19) |
| InChIKey | KRDBHVCEQWKUGZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|