C21H23FN2O4 — CID 33109872
N-[4-(4-fluorophenoxy)butyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetamide (PubChem CID 33109872) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetamide |
|---|---|
| PubChem CID | 33109872 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetamide |
| SMILES | O=C(COc1ccc2c(c1)CCC(=O)N2)NCCCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN2O4/c22-16-4-6-17(7-5-16)27-12-2-1-11-23-21(26)14-28-18-8-9-19-15(13-18)3-10-20(25)24-19/h4-9,13H,1-3,10-12,14H2,(H,23,26)(H,24,25) |
| InChIKey | SRENTOPXNKWZGD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|