C18H24N2O5 — CID 71936315
7-[[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]amino]heptanoic acid (PubChem CID 71936315) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 7-[[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]amino]heptanoic acid.
| Compound Name | 7-[[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 71936315 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 7-[[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)COc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C18H24N2O5/c21-16-9-6-13-11-14(7-8-15(13)20-16)25-12-17(22)19-10-4-2-1-3-5-18(23)24/h7-8,11H,1-6,9-10,12H2,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | GGAJQVDGVPFQCT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|