C21H26FIN4O2 — CID 111230362
1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide (PubChem CID 111230362) has the molecular formula C21H26FIN4O2 and a molecular weight of 512.37 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111230362 |
| Molecular Formula | C21H26FIN4O2 |
| Molecular Weight | 512.37 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc2c(c1)CCC(=O)N2)NCCc1ccc(F)cc1.I |
| InChI | InChI=1S/C21H25FN4O2.HI/c1-23-21(24-11-10-15-2-5-17(22)6-3-15)25-12-13-28-18-7-8-19-16(14-18)4-9-20(27)26-19;/h2-3,5-8,14H,4,9-13H2,1H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | XCUSHRVRPYWBIT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|