C23H29IN4O2S — CID 111557595
2-methyl-1-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 111557595) has the molecular formula C23H29IN4O2S and a molecular weight of 552.48 g/mol. Its IUPAC name is 2-methyl-1-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111557595 |
| Molecular Formula | C23H29IN4O2S |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 2-methyl-1-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc2c(c1)CCC(=O)N2)NCC1(Sc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H28N4O2S.HI/c1-24-22(26-16-23(11-12-23)30-19-5-3-2-4-6-19)25-13-14-29-18-8-9-20-17(15-18)7-10-21(28)27-20;/h2-6,8-9,15H,7,10-14,16H2,1H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | OKQYSFCROXYFPW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|