C20H33N5S — CID 111557735
1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine (PubChem CID 111557735) has the molecular formula C20H33N5S and a molecular weight of 375.59 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 111557735 |
| Molecular Formula | C20H33N5S |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine |
| SMILES | CCN1CCN(CCN/C(=N/C)NCC2(Sc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C20H33N5S/c1-3-24-13-15-25(16-14-24)12-11-22-19(21-2)23-17-20(9-10-20)26-18-7-5-4-6-8-18/h4-8H,3,9-17H2,1-2H3,(H2,21,22,23) |
| InChIKey | ZLGCGKSSVWFHNN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|