C16H22N6S — CID 111557376
2-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine (PubChem CID 111557376) has the molecular formula C16H22N6S and a molecular weight of 330.46 g/mol. Its IUPAC name is 2-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 111557376 |
| Molecular Formula | C16H22N6S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1nncn1C)NCC1(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C16H22N6S/c1-17-15(18-10-14-21-20-12-22(14)2)19-11-16(8-9-16)23-13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3,(H2,17,18,19) |
| InChIKey | JVLTYOOMPKTAEZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|