C20H29IN6S — CID 111557155
2-methyl-1-[(1-phenylsulfanylcyclopropyl)methyl]-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111557155) has the molecular formula C20H29IN6S and a molecular weight of 512.47 g/mol. Its IUPAC name is 2-methyl-1-[(1-phenylsulfanylcyclopropyl)methyl]-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-phenylsulfanylcyclopropyl)methyl]-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111557155 |
| Molecular Formula | C20H29IN6S |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 2-methyl-1-[(1-phenylsulfanylcyclopropyl)methyl]-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2n1CCCCC2)NCC1(Sc2ccccc2)CC1.I |
| InChI | InChI=1S/C20H28N6S.HI/c1-21-19(22-14-18-25-24-17-10-6-3-7-13-26(17)18)23-15-20(11-12-20)27-16-8-4-2-5-9-16;/h2,4-5,8-9H,3,6-7,10-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | ZFRUKGOUJZODPX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|