C19H26ClIN6 — CID 111640003
1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111640003) has the molecular formula C19H26ClIN6 and a molecular weight of 500.82 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111640003 |
| Molecular Formula | C19H26ClIN6 |
| Molecular Weight | 500.82 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2n1CCCC2)NCC1(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C19H25ClN6.HI/c1-21-18(22-12-17-25-24-16-7-2-3-10-26(16)17)23-13-19(8-9-19)14-5-4-6-15(20)11-14;/h4-6,11H,2-3,7-10,12-13H2,1H3,(H2,21,22,23);1H |
| InChIKey | CLCLQLMTBCNAIY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|