C19H27ClN6 — CID 111357910
1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine (PubChem CID 111357910) has the molecular formula C19H27ClN6 and a molecular weight of 374.92 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111357910 |
| Molecular Formula | C19H27ClN6 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1cccc(Cl)c1)NCCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C19H27ClN6/c1-21-19(22-11-9-15-6-5-7-16(20)14-15)23-12-10-18-25-24-17-8-3-2-4-13-26(17)18/h5-7,14H,2-4,8-13H2,1H3,(H2,21,22,23) |
| InChIKey | MZNWLUJKMXSMNL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|