C18H25Cl2IN6 — CID 111197575
1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111197575) has the molecular formula C18H25Cl2IN6 and a molecular weight of 523.25 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111197575 |
| Molecular Formula | C18H25Cl2IN6 |
| Molecular Weight | 523.25 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1nnc2n1CCCCC2)NCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C18H24Cl2N6.HI/c1-21-18(23-12-13-6-7-14(19)11-15(13)20)22-9-8-17-25-24-16-5-3-2-4-10-26(16)17;/h6-7,11H,2-5,8-10,12H2,1H3,(H2,21,22,23);1H |
| InChIKey | SXAYCBDPQQMFIY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|