C18H24Cl3IN6O — CID 109464179
2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide (PubChem CID 109464179) has the molecular formula C18H24Cl3IN6O and a molecular weight of 573.69 g/mol. Its IUPAC name is 2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109464179 |
| Molecular Formula | C18H24Cl3IN6O |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | 2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1c(Cl)cc(Cl)cc1Cl)NCc1nnc2n1CCCCC2.I |
| InChI | InChI=1S/C18H23Cl3N6O.HI/c1-22-18(23-6-8-28-17-13(20)9-12(19)10-14(17)21)24-11-16-26-25-15-5-3-2-4-7-27(15)16;/h9-10H,2-8,11H2,1H3,(H2,22,23,24);1H |
| InChIKey | DZXQFEXSCPDJBG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|