C17H30N6O — CID 111575331
1-(2-cycloheptyloxyethyl)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine (PubChem CID 111575331) has the molecular formula C17H30N6O and a molecular weight of 334.47 g/mol. Its IUPAC name is 1-(2-cycloheptyloxyethyl)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine.
| Compound Name | 1-(2-cycloheptyloxyethyl)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111575331 |
| Molecular Formula | C17H30N6O |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1-(2-cycloheptyloxyethyl)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCCOC1CCCCCC1)NCc1nnc2n1CCC2 |
| InChI | InChI=1S/C17H30N6O/c1-18-17(19-10-12-24-14-7-4-2-3-5-8-14)20-13-16-22-21-15-9-6-11-23(15)16/h14H,2-13H2,1H3,(H2,18,19,20) |
| InChIKey | WYPHRSBHXOMWEM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|