C13H25IN6 — CID 110979226
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 110979226) has the molecular formula C13H25IN6 and a molecular weight of 392.29 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110979226 |
| Molecular Formula | C13H25IN6 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(C)C)NCc1nnc2n1CCC2.I |
| InChI | InChI=1S/C13H24N6.HI/c1-10(2)6-7-15-13(14-3)16-9-12-18-17-11-5-4-8-19(11)12;/h10H,4-9H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | HVWRXWLECYEROY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|