C15H28N6 — CID 111203934
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-(5-methylhexan-2-yl)guanidine (PubChem CID 111203934) has the molecular formula C15H28N6 and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-(5-methylhexan-2-yl)guanidine.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-(5-methylhexan-2-yl)guanidine |
|---|---|
| PubChem CID | 111203934 |
| Molecular Formula | C15H28N6 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methyl-3-(5-methylhexan-2-yl)guanidine |
| SMILES | C/N=C(/NCc1nnc2n1CCC2)NC(C)CCC(C)C |
| InChI | InChI=1S/C15H28N6/c1-11(2)7-8-12(3)18-15(16-4)17-10-14-20-19-13-6-5-9-21(13)14/h11-12H,5-10H2,1-4H3,(H2,16,17,18) |
| InChIKey | VLVHWIYDGYHBRI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|