C12H22N6 — CID 110967076
1-tert-butyl-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine (PubChem CID 110967076) has the molecular formula C12H22N6 and a molecular weight of 250.35 g/mol. Its IUPAC name is 1-tert-butyl-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine.
| Compound Name | 1-tert-butyl-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 110967076 |
| Molecular Formula | C12H22N6 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-tert-butyl-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(/NCc1nnc2n1CCC2)NC(C)(C)C |
| InChI | InChI=1S/C12H22N6/c1-12(2,3)15-11(13-4)14-8-10-17-16-9-6-5-7-18(9)10/h5-8H2,1-4H3,(H2,13,14,15) |
| InChIKey | KQRRFQGSHXZWBY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|