C13H22N6 — CID 110982299
2-methyl-1-prop-2-enyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine (PubChem CID 110982299) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-prop-2-enyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110982299 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-methyl-1-prop-2-enyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
| SMILES | C=CCN/C(=N\C)NCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C13H22N6/c1-3-8-15-13(14-2)16-10-12-18-17-11-7-5-4-6-9-19(11)12/h3H,1,4-10H2,2H3,(H2,14,15,16) |
| InChIKey | VPCFAUURMFYIRE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|