C10H18N6 — CID 119117483
2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine (PubChem CID 119117483) has the molecular formula C10H18N6 and a molecular weight of 222.30 g/mol. Its IUPAC name is 2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119117483 |
| Molecular Formula | C10H18N6 |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\N)NCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C10H18N6/c1-12-10(11)13-7-9-15-14-8-5-3-2-4-6-16(8)9/h2-7H2,1H3,(H3,11,12,13) |
| InChIKey | GIGGMXLGMGEMAO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|