C17H25IN6O — CID 119131741
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[1-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 119131741) has the molecular formula C17H25IN6O and a molecular weight of 456.33 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[1-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[1-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119131741 |
| Molecular Formula | C17H25IN6O |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[1-(2-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2n1CCC2)NC(C)c1ccccc1OC.I |
| InChI | InChI=1S/C17H24N6O.HI/c1-12(13-7-4-5-8-14(13)24-3)20-17(18-2)19-11-16-22-21-15-9-6-10-23(15)16;/h4-5,7-8,12H,6,9-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | WOWDFAZWDNLLMG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|