C16H20F2N6O — CID 111020581
1-[[2-(difluoromethoxy)phenyl]methyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine (PubChem CID 111020581) has the molecular formula C16H20F2N6O and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111020581 |
| Molecular Formula | C16H20F2N6O |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccccc1OC(F)F)NCc1nnc2n1CCC2 |
| InChI | InChI=1S/C16H20F2N6O/c1-19-16(21-10-14-23-22-13-7-4-8-24(13)14)20-9-11-5-2-3-6-12(11)25-15(17)18/h2-3,5-6,15H,4,7-10H2,1H3,(H2,19,20,21) |
| InChIKey | AWXOTILOFVHCFV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|