C19H26F2IN7O — CID 111921312
1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 111921312) has the molecular formula C19H26F2IN7O and a molecular weight of 533.37 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111921312 |
| Molecular Formula | C19H26F2IN7O |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nnc2n1CCC2)NC1CCN(c2ccccc2OC(F)F)C1.I |
| InChI | InChI=1S/C19H25F2N7O.HI/c1-22-19(23-11-17-26-25-16-7-4-9-28(16)17)24-13-8-10-27(12-13)14-5-2-3-6-15(14)29-18(20)21;/h2-3,5-6,13,18H,4,7-12H2,1H3,(H2,22,23,24);1H |
| InChIKey | UCLNUJFHDZOMLG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|