C19H27ClIN7O — CID 111916894
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 111916894) has the molecular formula C19H27ClIN7O and a molecular weight of 531.83 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111916894 |
| Molecular Formula | C19H27ClIN7O |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nnc2n1CCC2)NC1CCN(c2cc(Cl)ccc2OC)C1.I |
| InChI | InChI=1S/C19H26ClN7O.HI/c1-21-19(22-11-18-25-24-17-4-3-8-27(17)18)23-14-7-9-26(12-14)15-10-13(20)5-6-16(15)28-2;/h5-6,10,14H,3-4,7-9,11-12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | PHAJXUPVUGZHGW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|